C22H21F3N4 — CID 56947353
6-(3-piperidin-4-ylphenyl)-N-[4-(trifluoromethyl)-2-pyridinyl]pyridin-2-amine (PubChem CID 56947353) has the molecular formula C22H21F3N4 and a molecular weight of 398.43 g/mol. Its IUPAC name is 6-(3-piperidin-4-ylphenyl)-N-[4-(trifluoromethyl)-2-pyridinyl]pyridin-2-amine.
| Compound Name | 6-(3-piperidin-4-ylphenyl)-N-[4-(trifluoromethyl)-2-pyridinyl]pyridin-2-amine |
|---|---|
| PubChem CID | 56947353 |
| Molecular Formula | C22H21F3N4 |
| Molecular Weight | 398.43 g/mol |
| Exact Mass | 398.17 |
| IUPAC Name | 6-(3-piperidin-4-ylphenyl)-N-[4-(trifluoromethyl)-2-pyridinyl]pyridin-2-amine |
| SMILES | FC(F)(F)c1ccnc(Nc2cccc(-c3cccc(C4CCNCC4)c3)n2)c1 |
| InChI | InChI=1S/C22H21F3N4/c23-22(24,25)18-9-12-27-21(14-18)29-20-6-2-5-19(28-20)17-4-1-3-16(13-17)15-7-10-26-11-8-15/h1-6,9,12-15,26H,7-8,10-11H2,(H,27,28,29) |
| InChIKey | OUKQRFLSGNKVTP-UHFFFAOYSA-N |
| XLogP | 5.37 |
| TPSA | 49.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.43 |
| LogP ≤ 5 | 5.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |