C16H15N5O2 — CID 19066013
1-ethyl-3-(7-oxo-2,5,8-triazatetracyclo[7.7.0.02,6.010,15]hexadeca-1(9),3,5,10(15),11,13-hexaen-13-yl)urea (PubChem CID 19066013) has the molecular formula C16H15N5O2 and a molecular weight of 309.33 g/mol. Its IUPAC name is 1-ethyl-3-(7-oxo-2,5,8-triazatetracyclo[7.7.0.02,6.010,15]hexadeca-1(9),3,5,10(15),11,13-hexaen-13-yl)urea.
| Compound Name | 1-ethyl-3-(7-oxo-2,5,8-triazatetracyclo[7.7.0.02,6.010,15]hexadeca-1(9),3,5,10(15),11,13-hexaen-13-yl)urea |
|---|---|
| PubChem CID | 19066013 |
| Molecular Formula | C16H15N5O2 |
| Molecular Weight | 309.33 g/mol |
| Exact Mass | 309.12 |
| IUPAC Name | 1-ethyl-3-(7-oxo-2,5,8-triazatetracyclo[7.7.0.02,6.010,15]hexadeca-1(9),3,5,10(15),11,13-hexaen-13-yl)urea |
| SMILES | CCNC(=O)Nc1ccc2c(c1)Cc1c-2[nH]c(=O)c2nccn12 |
| InChI | InChI=1S/C16H15N5O2/c1-2-17-16(23)19-10-3-4-11-9(7-10)8-12-13(11)20-15(22)14-18-5-6-21(12)14/h3-7H,2,8H2,1H3,(H,20,22)(H2,17,19,23) |
| InChIKey | XAGJFEPHEBFEFE-UHFFFAOYSA-N |
| XLogP | 1.74 |
| TPSA | 91.29 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.33 |
| LogP ≤ 5 | 1.74 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |