C14H28O2 — CID 19066613
1,2-ditert-butyl-3-hydroperoxycyclohexane (PubChem CID 19066613) has the molecular formula C14H28O2 and a molecular weight of 228.38 g/mol. Its IUPAC name is 1,2-ditert-butyl-3-hydroperoxycyclohexane.
| Compound Name | 1,2-ditert-butyl-3-hydroperoxycyclohexane |
|---|---|
| PubChem CID | 19066613 |
| Molecular Formula | C14H28O2 |
| Molecular Weight | 228.38 g/mol |
| Exact Mass | 228.21 |
| IUPAC Name | 1,2-ditert-butyl-3-hydroperoxycyclohexane |
| SMILES | CC(C)(C)C1CCCC(OO)C1C(C)(C)C |
| InChI | InChI=1S/C14H28O2/c1-13(2,3)10-8-7-9-11(16-15)12(10)14(4,5)6/h10-12,15H,7-9H2,1-6H3 |
| InChIKey | OXOCPAKQAHQLLP-UHFFFAOYSA-N |
| XLogP | 4.35 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 228.38 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|