C19H30N4O2 — CID 19068083
2-[4-[4-[2-(pyridazin-4-ylamino)ethyl]piperidin-1-yl]cyclohexyl]acetic acid (PubChem CID 19068083) has the molecular formula C19H30N4O2 and a molecular weight of 346.48 g/mol. Its IUPAC name is 2-[4-[4-[2-(pyridazin-4-ylamino)ethyl]piperidin-1-yl]cyclohexyl]acetic acid.
| Compound Name | 2-[4-[4-[2-(pyridazin-4-ylamino)ethyl]piperidin-1-yl]cyclohexyl]acetic acid |
|---|---|
| PubChem CID | 19068083 |
| Molecular Formula | C19H30N4O2 |
| Molecular Weight | 346.48 g/mol |
| Exact Mass | 346.24 |
| IUPAC Name | 2-[4-[4-[2-(pyridazin-4-ylamino)ethyl]piperidin-1-yl]cyclohexyl]acetic acid |
| SMILES | O=C(O)CC1CCC(N2CCC(CCNc3ccnnc3)CC2)CC1 |
| InChI | InChI=1S/C19H30N4O2/c24-19(25)13-16-1-3-18(4-2-16)23-11-7-15(8-12-23)5-9-20-17-6-10-21-22-14-17/h6,10,14-16,18H,1-5,7-9,11-13H2,(H,20,21)(H,24,25) |
| InChIKey | SLENTDOYRXGFCT-UHFFFAOYSA-N |
| XLogP | 3.02 |
| TPSA | 78.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.48 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |