C20H31N3O2 — CID 19068105
2-[4-[4-[2-(pyridin-4-ylamino)ethyl]piperidin-1-yl]cyclohexyl]acetic acid (PubChem CID 19068105) has the molecular formula C20H31N3O2 and a molecular weight of 345.49 g/mol. Its IUPAC name is 2-[4-[4-[2-(pyridin-4-ylamino)ethyl]piperidin-1-yl]cyclohexyl]acetic acid.
| Compound Name | 2-[4-[4-[2-(pyridin-4-ylamino)ethyl]piperidin-1-yl]cyclohexyl]acetic acid |
|---|---|
| PubChem CID | 19068105 |
| Molecular Formula | C20H31N3O2 |
| Molecular Weight | 345.49 g/mol |
| Exact Mass | 345.24 |
| IUPAC Name | 2-[4-[4-[2-(pyridin-4-ylamino)ethyl]piperidin-1-yl]cyclohexyl]acetic acid |
| SMILES | O=C(O)CC1CCC(N2CCC(CCNc3ccncc3)CC2)CC1 |
| InChI | InChI=1S/C20H31N3O2/c24-20(25)15-17-1-3-19(4-2-17)23-13-8-16(9-14-23)5-12-22-18-6-10-21-11-7-18/h6-7,10-11,16-17,19H,1-5,8-9,12-15H2,(H,21,22)(H,24,25) |
| InChIKey | XQEZWVLCPZMWHM-UHFFFAOYSA-N |
| XLogP | 3.63 |
| TPSA | 65.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.49 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |