C20H32N4O3 — CID 19068112
2-methoxy-2-[4-[4-[2-(pyridin-4-ylamino)ethyl]piperazin-1-yl]cyclohexyl]acetic acid (PubChem CID 19068112) has the molecular formula C20H32N4O3 and a molecular weight of 376.50 g/mol. Its IUPAC name is 2-methoxy-2-[4-[4-[2-(pyridin-4-ylamino)ethyl]piperazin-1-yl]cyclohexyl]acetic acid.
| Compound Name | 2-methoxy-2-[4-[4-[2-(pyridin-4-ylamino)ethyl]piperazin-1-yl]cyclohexyl]acetic acid |
|---|---|
| PubChem CID | 19068112 |
| Molecular Formula | C20H32N4O3 |
| Molecular Weight | 376.50 g/mol |
| Exact Mass | 376.25 |
| IUPAC Name | 2-methoxy-2-[4-[4-[2-(pyridin-4-ylamino)ethyl]piperazin-1-yl]cyclohexyl]acetic acid |
| SMILES | COC(C(=O)O)C1CCC(N2CCN(CCNc3ccncc3)CC2)CC1 |
| InChI | InChI=1S/C20H32N4O3/c1-27-19(20(25)26)16-2-4-18(5-3-16)24-14-12-23(13-15-24)11-10-22-17-6-8-21-9-7-17/h6-9,16,18-19H,2-5,10-15H2,1H3,(H,21,22)(H,25,26) |
| InChIKey | VHXJZDKGDBPCTI-UHFFFAOYSA-N |
| XLogP | 1.77 |
| TPSA | 77.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.50 |
| LogP ≤ 5 | 1.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |