C23H39N5O4S — CID 139796062
2-(butylsulfamoyl)-2-[4-[4-[2-(pyridin-4-ylamino)ethyl]piperazin-1-yl]cyclohexyl]acetic acid (PubChem CID 139796062) has the molecular formula C23H39N5O4S and a molecular weight of 481.66 g/mol. Its IUPAC name is 2-(butylsulfamoyl)-2-[4-[4-[2-(pyridin-4-ylamino)ethyl]piperazin-1-yl]cyclohexyl]acetic acid.
| Compound Name | 2-(butylsulfamoyl)-2-[4-[4-[2-(pyridin-4-ylamino)ethyl]piperazin-1-yl]cyclohexyl]acetic acid |
|---|---|
| PubChem CID | 139796062 |
| Molecular Formula | C23H39N5O4S |
| Molecular Weight | 481.66 g/mol |
| Exact Mass | 481.27 |
| IUPAC Name | 2-(butylsulfamoyl)-2-[4-[4-[2-(pyridin-4-ylamino)ethyl]piperazin-1-yl]cyclohexyl]acetic acid |
| SMILES | CCCCNS(=O)(=O)C(C(=O)O)C1CCC(N2CCN(CCNc3ccncc3)CC2)CC1 |
| InChI | InChI=1S/C23H39N5O4S/c1-2-3-10-26-33(31,32)22(23(29)30)19-4-6-21(7-5-19)28-17-15-27(16-18-28)14-13-25-20-8-11-24-12-9-20/h8-9,11-12,19,21-22,26H,2-7,10,13-18H2,1H3,(H,24,25)(H,29,30) |
| InChIKey | HSDAMWIHUWWQAC-UHFFFAOYSA-N |
| XLogP | 1.84 |
| TPSA | 114.87 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.66 |
| LogP ≤ 5 | 1.84 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|