C22H15BrClF3N2O2S — CID 19072855
N-[[4-(4-bromo-2-fluorophenoxy)-3-chloro-2,5-dimethylphenyl]carbamothioyl]-2,6-difluorobenzamide (PubChem CID 19072855) has the molecular formula C22H15BrClF3N2O2S and a molecular weight of 543.79 g/mol. Its IUPAC name is N-[[4-(4-bromo-2-fluorophenoxy)-3-chloro-2,5-dimethylphenyl]carbamothioyl]-2,6-difluorobenzamide.
| Compound Name | N-[[4-(4-bromo-2-fluorophenoxy)-3-chloro-2,5-dimethylphenyl]carbamothioyl]-2,6-difluorobenzamide |
|---|---|
| PubChem CID | 19072855 |
| Molecular Formula | C22H15BrClF3N2O2S |
| Molecular Weight | 543.79 g/mol |
| Exact Mass | 541.97 |
| IUPAC Name | N-[[4-(4-bromo-2-fluorophenoxy)-3-chloro-2,5-dimethylphenyl]carbamothioyl]-2,6-difluorobenzamide |
| SMILES | Cc1cc(NC(=S)NC(=O)c2c(F)cccc2F)c(C)c(Cl)c1Oc1ccc(Br)cc1F |
| InChI | InChI=1S/C22H15BrClF3N2O2S/c1-10-8-16(28-22(32)29-21(30)18-13(25)4-3-5-14(18)26)11(2)19(24)20(10)31-17-7-6-12(23)9-15(17)27/h3-9H,1-2H3,(H2,28,29,30,32) |
| InChIKey | CTRTWETUOOOKLC-UHFFFAOYSA-N |
| XLogP | 7.06 |
| TPSA | 50.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 543.79 |
| LogP ≤ 5 | 7.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|