C22H15ClF2N4O2S — CID 19072923
N-[[3-chloro-4-[(5-cyano-2-pyridinyl)oxy]-2,5-dimethylphenyl]carbamothioyl]-2,6-difluorobenzamide (PubChem CID 19072923) has the molecular formula C22H15ClF2N4O2S and a molecular weight of 472.90 g/mol. Its IUPAC name is N-[[3-chloro-4-[(5-cyano-2-pyridinyl)oxy]-2,5-dimethylphenyl]carbamothioyl]-2,6-difluorobenzamide.
| Compound Name | N-[[3-chloro-4-[(5-cyano-2-pyridinyl)oxy]-2,5-dimethylphenyl]carbamothioyl]-2,6-difluorobenzamide |
|---|---|
| PubChem CID | 19072923 |
| Molecular Formula | C22H15ClF2N4O2S |
| Molecular Weight | 472.90 g/mol |
| Exact Mass | 472.06 |
| IUPAC Name | N-[[3-chloro-4-[(5-cyano-2-pyridinyl)oxy]-2,5-dimethylphenyl]carbamothioyl]-2,6-difluorobenzamide |
| SMILES | Cc1cc(NC(=S)NC(=O)c2c(F)cccc2F)c(C)c(Cl)c1Oc1ccc(C#N)cn1 |
| InChI | InChI=1S/C22H15ClF2N4O2S/c1-11-8-16(28-22(32)29-21(30)18-14(24)4-3-5-15(18)25)12(2)19(23)20(11)31-17-7-6-13(9-26)10-27-17/h3-8,10H,1-2H3,(H2,28,29,30,32) |
| InChIKey | XFYBHONEEDYYSD-UHFFFAOYSA-N |
| XLogP | 5.42 |
| TPSA | 87.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.90 |
| LogP ≤ 5 | 5.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|