C12H20Cl2N2OS — CID 19079083
N-(4-pyridin-4-ylsulfanylbutyl)propanamide;dihydrochloride (PubChem CID 19079083) has the molecular formula C12H20Cl2N2OS and a molecular weight of 311.28 g/mol. Its IUPAC name is N-(4-pyridin-4-ylsulfanylbutyl)propanamide;dihydrochloride.
| Compound Name | N-(4-pyridin-4-ylsulfanylbutyl)propanamide;dihydrochloride |
|---|---|
| PubChem CID | 19079083 |
| Molecular Formula | C12H20Cl2N2OS |
| Molecular Weight | 311.28 g/mol |
| Exact Mass | 310.07 |
| IUPAC Name | N-(4-pyridin-4-ylsulfanylbutyl)propanamide;dihydrochloride |
| SMILES | CCC(=O)NCCCCSc1ccncc1.Cl.Cl |
| InChI | InChI=1S/C12H18N2OS.2ClH/c1-2-12(15)14-7-3-4-10-16-11-5-8-13-9-6-11;;/h5-6,8-9H,2-4,7,10H2,1H3,(H,14,15);2*1H |
| InChIKey | TZQOJOGJPPGHRA-UHFFFAOYSA-N |
| XLogP | 3.32 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.28 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|