C16H21Cl2N3OS — CID 19079248
2-amino-N-(4-pyridin-4-ylsulfanylbutyl)benzamide;dihydrochloride (PubChem CID 19079248) has the molecular formula C16H21Cl2N3OS and a molecular weight of 374.34 g/mol. Its IUPAC name is 2-amino-N-(4-pyridin-4-ylsulfanylbutyl)benzamide;dihydrochloride.
| Compound Name | 2-amino-N-(4-pyridin-4-ylsulfanylbutyl)benzamide;dihydrochloride |
|---|---|
| PubChem CID | 19079248 |
| Molecular Formula | C16H21Cl2N3OS |
| Molecular Weight | 374.34 g/mol |
| Exact Mass | 373.08 |
| IUPAC Name | 2-amino-N-(4-pyridin-4-ylsulfanylbutyl)benzamide;dihydrochloride |
| SMILES | Cl.Cl.Nc1ccccc1C(=O)NCCCCSc1ccncc1 |
| InChI | InChI=1S/C16H19N3OS.2ClH/c17-15-6-2-1-5-14(15)16(20)19-9-3-4-12-21-13-7-10-18-11-8-13;;/h1-2,5-8,10-11H,3-4,9,12,17H2,(H,19,20);2*1H |
| InChIKey | DYWLHDWTPXABNI-UHFFFAOYSA-N |
| XLogP | 3.81 |
| TPSA | 68.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.34 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|