C17H33NO4 — CID 19082556
1-butoxybutane;2-hydroxy-N-(3-oxohept-1-en-4-yl)acetamide (PubChem CID 19082556) has the molecular formula C17H33NO4 and a molecular weight of 315.45 g/mol. Its IUPAC name is 1-butoxybutane;2-hydroxy-N-(3-oxohept-1-en-4-yl)acetamide.
| Compound Name | 1-butoxybutane;2-hydroxy-N-(3-oxohept-1-en-4-yl)acetamide |
|---|---|
| PubChem CID | 19082556 |
| Molecular Formula | C17H33NO4 |
| Molecular Weight | 315.45 g/mol |
| Exact Mass | 315.24 |
| IUPAC Name | 1-butoxybutane;2-hydroxy-N-(3-oxohept-1-en-4-yl)acetamide |
| SMILES | C=CC(=O)C(CCC)NC(=O)CO.CCCCOCCCC |
| InChI | InChI=1S/C9H15NO3.C8H18O/c1-3-5-7(8(12)4-2)10-9(13)6-11;1-3-5-7-9-8-6-4-2/h4,7,11H,2-3,5-6H2,1H3,(H,10,13);3-8H2,1-2H3 |
| InChIKey | CTBNZASRJXIIRB-UHFFFAOYSA-N |
| XLogP | 2.62 |
| TPSA | 75.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.45 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|