C8H10N4O4 — CID 19085513
1-(2,3-dioxopiperazin-1-yl)piperazine-2,3-dione (PubChem CID 19085513) has the molecular formula C8H10N4O4 and a molecular weight of 226.19 g/mol. Its IUPAC name is 1-(2,3-dioxopiperazin-1-yl)piperazine-2,3-dione.
| Compound Name | 1-(2,3-dioxopiperazin-1-yl)piperazine-2,3-dione |
|---|---|
| PubChem CID | 19085513 |
| Molecular Formula | C8H10N4O4 |
| Molecular Weight | 226.19 g/mol |
| Exact Mass | 226.07 |
| IUPAC Name | 1-(2,3-dioxopiperazin-1-yl)piperazine-2,3-dione |
| SMILES | O=C1NCCN(N2CCNC(=O)C2=O)C1=O |
| InChI | InChI=1S/C8H10N4O4/c13-5-7(15)11(3-1-9-5)12-4-2-10-6(14)8(12)16/h1-4H2,(H,9,13)(H,10,14) |
| InChIKey | PPCOBUITQSTXCS-UHFFFAOYSA-N |
| XLogP | -3.18 |
| TPSA | 98.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 226.19 |
| LogP ≤ 5 | -3.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|