C11H20N2O — CID 19086637
1-[(6-amino-1-methylcyclohexa-2,4-dien-1-yl)-ethylamino]ethanol (PubChem CID 19086637) has the molecular formula C11H20N2O and a molecular weight of 196.29 g/mol. Its IUPAC name is 1-[(6-amino-1-methylcyclohexa-2,4-dien-1-yl)-ethylamino]ethanol.
| Compound Name | 1-[(6-amino-1-methylcyclohexa-2,4-dien-1-yl)-ethylamino]ethanol |
|---|---|
| PubChem CID | 19086637 |
| Molecular Formula | C11H20N2O |
| Molecular Weight | 196.29 g/mol |
| Exact Mass | 196.16 |
| IUPAC Name | 1-[(6-amino-1-methylcyclohexa-2,4-dien-1-yl)-ethylamino]ethanol |
| SMILES | CCN(C(C)O)C1(C)C=CC=CC1N |
| InChI | InChI=1S/C11H20N2O/c1-4-13(9(2)14)11(3)8-6-5-7-10(11)12/h5-10,14H,4,12H2,1-3H3 |
| InChIKey | IMKACTUPRVVWNI-UHFFFAOYSA-N |
| XLogP | 0.86 |
| TPSA | 49.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 196.29 |
| LogP ≤ 5 | 0.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|