C18H15ClO3 — CID 19088566
2-[(11E)-11-(2-chloroethylidene)-6H-benzo[c][1]benzoxepin-2-yl]acetic acid (PubChem CID 19088566) has the molecular formula C18H15ClO3 and a molecular weight of 314.77 g/mol. Its IUPAC name is 2-[(11E)-11-(2-chloroethylidene)-6H-benzo[c][1]benzoxepin-2-yl]acetic acid.
| Compound Name | 2-[(11E)-11-(2-chloroethylidene)-6H-benzo[c][1]benzoxepin-2-yl]acetic acid |
|---|---|
| PubChem CID | 19088566 |
| Molecular Formula | C18H15ClO3 |
| Molecular Weight | 314.77 g/mol |
| Exact Mass | 314.07 |
| IUPAC Name | 2-[(11E)-11-(2-chloroethylidene)-6H-benzo[c][1]benzoxepin-2-yl]acetic acid |
| SMILES | O=C(O)Cc1ccc2c(c1)/C(=C/CCl)c1ccccc1CO2 |
| InChI | InChI=1S/C18H15ClO3/c19-8-7-15-14-4-2-1-3-13(14)11-22-17-6-5-12(9-16(15)17)10-18(20)21/h1-7,9H,8,10-11H2,(H,20,21)/b15-7+ |
| InChIKey | GVOWDILFFOCAOK-VIZOYTHASA-N |
| XLogP | 3.88 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.77 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|