C7H10F6 — CID 19091141
3,3-bis(trifluoromethyl)pentane (PubChem CID 19091141) has the molecular formula C7H10F6 and a molecular weight of 208.14 g/mol. Its IUPAC name is 3,3-bis(trifluoromethyl)pentane.
| Compound Name | 3,3-bis(trifluoromethyl)pentane |
|---|---|
| PubChem CID | 19091141 |
| Molecular Formula | C7H10F6 |
| Molecular Weight | 208.14 g/mol |
| Exact Mass | 208.07 |
| IUPAC Name | 3,3-bis(trifluoromethyl)pentane |
| SMILES | CCC(CC)(C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C7H10F6/c1-3-5(4-2,6(8,9)10)7(11,12)13/h3-4H2,1-2H3 |
| InChIKey | NPSRBSXJNVUUBM-UHFFFAOYSA-N |
| XLogP | 3.92 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 208.14 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |