About ethyl-methoxy-dioctylazanium;propanoate
ethyl-methoxy-dioctylazanium;propanoate (PubChem CID 19091174) has the molecular formula C22H47NO3
and a molecular weight of 373.62 g/mol. Its IUPAC name is ethyl-methoxy-dioctylazanium;propanoate.
Molecular Properties
| Compound Name | ethyl-methoxy-dioctylazanium;propanoate |
| PubChem CID | 19091174 |
| Molecular Formula | C22H47NO3 |
| Molecular Weight | 373.62 g/mol |
| Exact Mass | 373.36 |
| IUPAC Name | ethyl-methoxy-dioctylazanium;propanoate |
| SMILES | CCC(=O)[O-].CCCCCCCC[N+](CC)(CCCCCCCC)OC |
| InChI | InChI=1S/C19H42NO.C3H6O2/c1-5-8-10-12-14-16-18-20(7-3,21-4)19-17-15-13-11-9-6-2;1-2-3(4)5/h5-19H2,1-4H3;2H2,1H3,(H,4,5)/q+1;/p-1 |
| InChIKey | PBRLYEDEKXCVRF-UHFFFAOYSA-M |
| XLogP | 5.25 |
| TPSA | 49.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 373.62 |
| LogP ≤ 5 | 5.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|
Analyze ethyl-methoxy-dioctylazanium;propanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl-methoxy-dioctylazanium;propanoate?
The IUPAC name of ethyl-methoxy-dioctylazanium;propanoate (CID 19091174) is ethyl-methoxy-dioctylazanium;propanoate.
What is the SMILES notation for ethyl-methoxy-dioctylazanium;propanoate?
The canonical SMILES for ethyl-methoxy-dioctylazanium;propanoate is CCC(=O)[O-].CCCCCCCC[N+](CC)(CCCCCCCC)OC.
What is the InChIKey of ethyl-methoxy-dioctylazanium;propanoate?
The InChIKey is PBRLYEDEKXCVRF-UHFFFAOYSA-M. The full InChI is InChI=1S/C19H42NO.C3H6O2/c1-5-8-10-12-14-16-18-20(7-3,21-4)19-17-15-13-11-9-6-2;1-2-3(4)5/h5-19H2,1-4H3;2H2,1H3,(H,4,5)/q+1;/p-1.
What are the key properties of ethyl-methoxy-dioctylazanium;propanoate?
ethyl-methoxy-dioctylazanium;propanoate has a molecular weight of 373.62 g/mol, XLogP of 5.25, 17 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl-methoxy-dioctylazanium;propanoate is sourced from PubChem (CID 19091174), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).