C23H32ClN3O3S — CID 19093850
N-[2-(7-hexyl-7-methyl-4,5-dihydrothieno[2,3-c]pyridin-6-yl)ethyl]-4-nitrobenzamide;hydrochloride (PubChem CID 19093850) has the molecular formula C23H32ClN3O3S and a molecular weight of 466.05 g/mol. Its IUPAC name is N-[2-(7-hexyl-7-methyl-4,5-dihydrothieno[2,3-c]pyridin-6-yl)ethyl]-4-nitrobenzamide;hydrochloride.
| Compound Name | N-[2-(7-hexyl-7-methyl-4,5-dihydrothieno[2,3-c]pyridin-6-yl)ethyl]-4-nitrobenzamide;hydrochloride |
|---|---|
| PubChem CID | 19093850 |
| Molecular Formula | C23H32ClN3O3S |
| Molecular Weight | 466.05 g/mol |
| Exact Mass | 465.19 |
| IUPAC Name | N-[2-(7-hexyl-7-methyl-4,5-dihydrothieno[2,3-c]pyridin-6-yl)ethyl]-4-nitrobenzamide;hydrochloride |
| SMILES | CCCCCCC1(C)c2sccc2CCN1CCNC(=O)c1ccc([N+](=O)[O-])cc1.Cl |
| InChI | InChI=1S/C23H31N3O3S.ClH/c1-3-4-5-6-13-23(2)21-18(12-17-30-21)11-15-25(23)16-14-24-22(27)19-7-9-20(10-8-19)26(28)29;/h7-10,12,17H,3-6,11,13-16H2,1-2H3,(H,24,27);1H |
| InChIKey | IFEWGZRTKFLURS-UHFFFAOYSA-N |
| XLogP | 5.55 |
| TPSA | 75.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.05 |
| LogP ≤ 5 | 5.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|