C23H23Cl2N3O3S — CID 19093856
N-[2-[7-(4-chlorophenyl)-5-methyl-5,7-dihydro-4H-thieno[2,3-c]pyridin-6-yl]ethyl]-4-nitrobenzamide;hydrochloride (PubChem CID 19093856) has the molecular formula C23H23Cl2N3O3S and a molecular weight of 492.43 g/mol. Its IUPAC name is N-[2-[7-(4-chlorophenyl)-5-methyl-5,7-dihydro-4H-thieno[2,3-c]pyridin-6-yl]ethyl]-4-nitrobenzamide;hydrochloride.
| Compound Name | N-[2-[7-(4-chlorophenyl)-5-methyl-5,7-dihydro-4H-thieno[2,3-c]pyridin-6-yl]ethyl]-4-nitrobenzamide;hydrochloride |
|---|---|
| PubChem CID | 19093856 |
| Molecular Formula | C23H23Cl2N3O3S |
| Molecular Weight | 492.43 g/mol |
| Exact Mass | 491.08 |
| IUPAC Name | N-[2-[7-(4-chlorophenyl)-5-methyl-5,7-dihydro-4H-thieno[2,3-c]pyridin-6-yl]ethyl]-4-nitrobenzamide;hydrochloride |
| SMILES | CC1Cc2ccsc2C(c2ccc(Cl)cc2)N1CCNC(=O)c1ccc([N+](=O)[O-])cc1.Cl |
| InChI | InChI=1S/C23H22ClN3O3S.ClH/c1-15-14-18-10-13-31-22(18)21(16-2-6-19(24)7-3-16)26(15)12-11-25-23(28)17-4-8-20(9-5-17)27(29)30;/h2-10,13,15,21H,11-12,14H2,1H3,(H,25,28);1H |
| InChIKey | ATBURZOXSLEKLU-UHFFFAOYSA-N |
| XLogP | 5.50 |
| TPSA | 75.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.43 |
| LogP ≤ 5 | 5.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|