C18H21N3O3S — CID 54234122
N-[2-[(5R,7S)-5,7-dimethyl-5,7-dihydro-4H-thieno[2,3-c]pyridin-6-yl]ethyl]-2-nitrobenzamide (PubChem CID 54234122) has the molecular formula C18H21N3O3S and a molecular weight of 359.45 g/mol. Its IUPAC name is N-[2-[(5R,7S)-5,7-dimethyl-5,7-dihydro-4H-thieno[2,3-c]pyridin-6-yl]ethyl]-2-nitrobenzamide.
| Compound Name | N-[2-[(5R,7S)-5,7-dimethyl-5,7-dihydro-4H-thieno[2,3-c]pyridin-6-yl]ethyl]-2-nitrobenzamide |
|---|---|
| PubChem CID | 54234122 |
| Molecular Formula | C18H21N3O3S |
| Molecular Weight | 359.45 g/mol |
| Exact Mass | 359.13 |
| IUPAC Name | N-[2-[(5R,7S)-5,7-dimethyl-5,7-dihydro-4H-thieno[2,3-c]pyridin-6-yl]ethyl]-2-nitrobenzamide |
| SMILES | C[C@@H]1Cc2ccsc2[C@H](C)N1CCNC(=O)c1ccccc1[N+](=O)[O-] |
| InChI | InChI=1S/C18H21N3O3S/c1-12-11-14-7-10-25-17(14)13(2)20(12)9-8-19-18(22)15-5-3-4-6-16(15)21(23)24/h3-7,10,12-13H,8-9,11H2,1-2H3,(H,19,22)/t12-,13+/m1/s1 |
| InChIKey | QLIHFXFJDOMCGC-OLZOCXBDSA-N |
| XLogP | 3.39 |
| TPSA | 75.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.45 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|