C16H18ClN3O3S — CID 19093900
N-[2-(5,7-dihydro-4H-thieno[2,3-c]pyridin-6-yl)ethyl]-2-nitrobenzamide;hydrochloride (PubChem CID 19093900) has the molecular formula C16H18ClN3O3S and a molecular weight of 367.86 g/mol. Its IUPAC name is N-[2-(5,7-dihydro-4H-thieno[2,3-c]pyridin-6-yl)ethyl]-2-nitrobenzamide;hydrochloride.
| Compound Name | N-[2-(5,7-dihydro-4H-thieno[2,3-c]pyridin-6-yl)ethyl]-2-nitrobenzamide;hydrochloride |
|---|---|
| PubChem CID | 19093900 |
| Molecular Formula | C16H18ClN3O3S |
| Molecular Weight | 367.86 g/mol |
| Exact Mass | 367.08 |
| IUPAC Name | N-[2-(5,7-dihydro-4H-thieno[2,3-c]pyridin-6-yl)ethyl]-2-nitrobenzamide;hydrochloride |
| SMILES | Cl.O=C(NCCN1CCc2ccsc2C1)c1ccccc1[N+](=O)[O-] |
| InChI | InChI=1S/C16H17N3O3S.ClH/c20-16(13-3-1-2-4-14(13)19(21)22)17-7-9-18-8-5-12-6-10-23-15(12)11-18;/h1-4,6,10H,5,7-9,11H2,(H,17,20);1H |
| InChIKey | ROYJXKXAJZRWQL-UHFFFAOYSA-N |
| XLogP | 2.87 |
| TPSA | 75.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.86 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|