C20H28N6O5 — CID 19094636
2-[3-butan-2-yl-4-[2-[[4-(diaminomethylideneamino)benzoyl]amino]acetyl]-2-oxopiperazin-1-yl]acetic acid (PubChem CID 19094636) has the molecular formula C20H28N6O5 and a molecular weight of 432.48 g/mol. Its IUPAC name is 2-[3-butan-2-yl-4-[2-[[4-(diaminomethylideneamino)benzoyl]amino]acetyl]-2-oxopiperazin-1-yl]acetic acid.
| Compound Name | 2-[3-butan-2-yl-4-[2-[[4-(diaminomethylideneamino)benzoyl]amino]acetyl]-2-oxopiperazin-1-yl]acetic acid |
|---|---|
| PubChem CID | 19094636 |
| Molecular Formula | C20H28N6O5 |
| Molecular Weight | 432.48 g/mol |
| Exact Mass | 432.21 |
| IUPAC Name | 2-[3-butan-2-yl-4-[2-[[4-(diaminomethylideneamino)benzoyl]amino]acetyl]-2-oxopiperazin-1-yl]acetic acid |
| SMILES | CCC(C)C1C(=O)N(CC(=O)O)CCN1C(=O)CNC(=O)c1ccc(N=C(N)N)cc1 |
| InChI | InChI=1S/C20H28N6O5/c1-3-12(2)17-19(31)25(11-16(28)29)8-9-26(17)15(27)10-23-18(30)13-4-6-14(7-5-13)24-20(21)22/h4-7,12,17H,3,8-11H2,1-2H3,(H,23,30)(H,28,29)(H4,21,22,24) |
| InChIKey | KCRZGBKXLPMLQK-UHFFFAOYSA-N |
| XLogP | -0.51 |
| TPSA | 171.42 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.48 |
| LogP ≤ 5 | -0.51 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|