C20H26ClNO — CID 19095553
1-benzyl-3-(2,3-dimethylphenyl)piperidin-3-ol;hydrochloride (PubChem CID 19095553) has the molecular formula C20H26ClNO and a molecular weight of 331.89 g/mol. Its IUPAC name is 1-benzyl-3-(2,3-dimethylphenyl)piperidin-3-ol;hydrochloride.
| Compound Name | 1-benzyl-3-(2,3-dimethylphenyl)piperidin-3-ol;hydrochloride |
|---|---|
| PubChem CID | 19095553 |
| Molecular Formula | C20H26ClNO |
| Molecular Weight | 331.89 g/mol |
| Exact Mass | 331.17 |
| IUPAC Name | 1-benzyl-3-(2,3-dimethylphenyl)piperidin-3-ol;hydrochloride |
| SMILES | Cc1cccc(C2(O)CCCN(Cc3ccccc3)C2)c1C.Cl |
| InChI | InChI=1S/C20H25NO.ClH/c1-16-8-6-11-19(17(16)2)20(22)12-7-13-21(15-20)14-18-9-4-3-5-10-18;/h3-6,8-11,22H,7,12-15H2,1-2H3;1H |
| InChIKey | QYVKPFCWDRNFQE-UHFFFAOYSA-N |
| XLogP | 4.21 |
| TPSA | 23.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.89 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |