C22H29NO3 — CID 44514801
1-benzyl-3-[2-(2,2-dimethoxyethyl)phenyl]piperidin-3-ol (PubChem CID 44514801) has the molecular formula C22H29NO3 and a molecular weight of 355.48 g/mol. Its IUPAC name is 1-benzyl-3-[2-(2,2-dimethoxyethyl)phenyl]piperidin-3-ol.
| Compound Name | 1-benzyl-3-[2-(2,2-dimethoxyethyl)phenyl]piperidin-3-ol |
|---|---|
| PubChem CID | 44514801 |
| Molecular Formula | C22H29NO3 |
| Molecular Weight | 355.48 g/mol |
| Exact Mass | 355.21 |
| IUPAC Name | 1-benzyl-3-[2-(2,2-dimethoxyethyl)phenyl]piperidin-3-ol |
| SMILES | COC(Cc1ccccc1C1(O)CCCN(Cc2ccccc2)C1)OC |
| InChI | InChI=1S/C22H29NO3/c1-25-21(26-2)15-19-11-6-7-12-20(19)22(24)13-8-14-23(17-22)16-18-9-4-3-5-10-18/h3-7,9-12,21,24H,8,13-17H2,1-2H3 |
| InChIKey | RGYRZZUUDCEXBT-UHFFFAOYSA-N |
| XLogP | 3.33 |
| TPSA | 41.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.48 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|