C15H17ClF3NO3 — CID 19095605
ethyl 3-[4-chloro-3-(trifluoromethyl)phenyl]-3-hydroxypiperidine-1-carboxylate (PubChem CID 19095605) has the molecular formula C15H17ClF3NO3 and a molecular weight of 351.75 g/mol. Its IUPAC name is ethyl 3-[4-chloro-3-(trifluoromethyl)phenyl]-3-hydroxypiperidine-1-carboxylate.
| Compound Name | ethyl 3-[4-chloro-3-(trifluoromethyl)phenyl]-3-hydroxypiperidine-1-carboxylate |
|---|---|
| PubChem CID | 19095605 |
| Molecular Formula | C15H17ClF3NO3 |
| Molecular Weight | 351.75 g/mol |
| Exact Mass | 351.08 |
| IUPAC Name | ethyl 3-[4-chloro-3-(trifluoromethyl)phenyl]-3-hydroxypiperidine-1-carboxylate |
| SMILES | CCOC(=O)N1CCCC(O)(c2ccc(Cl)c(C(F)(F)F)c2)C1 |
| InChI | InChI=1S/C15H17ClF3NO3/c1-2-23-13(21)20-7-3-6-14(22,9-20)10-4-5-12(16)11(8-10)15(17,18)19/h4-5,8,22H,2-3,6-7,9H2,1H3 |
| InChIKey | HKZMQOFWQOGNRF-UHFFFAOYSA-N |
| XLogP | 3.80 |
| TPSA | 49.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.75 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |