C22H25N3O6S — CID 19095729
N-[6-(1-hydroxyethoxy)-5-(2-methoxyphenoxy)pyrimidin-4-yl]-4-propan-2-ylbenzenesulfonamide (PubChem CID 19095729) has the molecular formula C22H25N3O6S and a molecular weight of 459.52 g/mol. Its IUPAC name is N-[6-(1-hydroxyethoxy)-5-(2-methoxyphenoxy)pyrimidin-4-yl]-4-propan-2-ylbenzenesulfonamide.
| Compound Name | N-[6-(1-hydroxyethoxy)-5-(2-methoxyphenoxy)pyrimidin-4-yl]-4-propan-2-ylbenzenesulfonamide |
|---|---|
| PubChem CID | 19095729 |
| Molecular Formula | C22H25N3O6S |
| Molecular Weight | 459.52 g/mol |
| Exact Mass | 459.15 |
| IUPAC Name | N-[6-(1-hydroxyethoxy)-5-(2-methoxyphenoxy)pyrimidin-4-yl]-4-propan-2-ylbenzenesulfonamide |
| SMILES | COc1ccccc1Oc1c(NS(=O)(=O)c2ccc(C(C)C)cc2)ncnc1OC(C)O |
| InChI | InChI=1S/C22H25N3O6S/c1-14(2)16-9-11-17(12-10-16)32(27,28)25-21-20(22(24-13-23-21)30-15(3)26)31-19-8-6-5-7-18(19)29-4/h5-15,26H,1-4H3,(H,23,24,25) |
| InChIKey | FSHRNUMCPCXRNT-UHFFFAOYSA-N |
| XLogP | 3.92 |
| TPSA | 119.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.52 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|