C23H25N3O9S — CID 54138700
2-[4-[[6-(2-hydroxyethoxy)-5-(2-methoxyphenoxy)pyrimidin-4-yl]sulfamoyl]phenoxy]ethyl acetate (PubChem CID 54138700) has the molecular formula C23H25N3O9S and a molecular weight of 519.53 g/mol. Its IUPAC name is 2-[4-[[6-(2-hydroxyethoxy)-5-(2-methoxyphenoxy)pyrimidin-4-yl]sulfamoyl]phenoxy]ethyl acetate.
| Compound Name | 2-[4-[[6-(2-hydroxyethoxy)-5-(2-methoxyphenoxy)pyrimidin-4-yl]sulfamoyl]phenoxy]ethyl acetate |
|---|---|
| PubChem CID | 54138700 |
| Molecular Formula | C23H25N3O9S |
| Molecular Weight | 519.53 g/mol |
| Exact Mass | 519.13 |
| IUPAC Name | 2-[4-[[6-(2-hydroxyethoxy)-5-(2-methoxyphenoxy)pyrimidin-4-yl]sulfamoyl]phenoxy]ethyl acetate |
| SMILES | COc1ccccc1Oc1c(NS(=O)(=O)c2ccc(OCCOC(C)=O)cc2)ncnc1OCCO |
| InChI | InChI=1S/C23H25N3O9S/c1-16(28)32-13-14-33-17-7-9-18(10-8-17)36(29,30)26-22-21(23(25-15-24-22)34-12-11-27)35-20-6-4-3-5-19(20)31-2/h3-10,15,27H,11-14H2,1-2H3,(H,24,25,26) |
| InChIKey | NZOBVAOYFSCOEE-UHFFFAOYSA-N |
| XLogP | 2.39 |
| TPSA | 155.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 519.53 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|