C23H26N5O6S+ — CID 44629287
4-[(4-tert-butylphenyl)sulfonylamino]-6-(2-hydroxyethoxy)-5-(2-methoxyphenoxy)pyrimidine-2-diazonium (PubChem CID 44629287) has the molecular formula C23H26N5O6S+ and a molecular weight of 500.56 g/mol. Its IUPAC name is 4-[(4-tert-butylphenyl)sulfonylamino]-6-(2-hydroxyethoxy)-5-(2-methoxyphenoxy)pyrimidine-2-diazonium.
| Compound Name | 4-[(4-tert-butylphenyl)sulfonylamino]-6-(2-hydroxyethoxy)-5-(2-methoxyphenoxy)pyrimidine-2-diazonium |
|---|---|
| PubChem CID | 44629287 |
| Molecular Formula | C23H26N5O6S+ |
| Molecular Weight | 500.56 g/mol |
| Exact Mass | 500.16 |
| IUPAC Name | 4-[(4-tert-butylphenyl)sulfonylamino]-6-(2-hydroxyethoxy)-5-(2-methoxyphenoxy)pyrimidine-2-diazonium |
| SMILES | COc1ccccc1Oc1c(NS(=O)(=O)c2ccc(C(C)(C)C)cc2)nc([N+]#N)nc1OCCO |
| InChI | InChI=1S/C23H26N5O6S/c1-23(2,3)15-9-11-16(12-10-15)35(30,31)28-20-19(34-18-8-6-5-7-17(18)32-4)21(33-14-13-29)26-22(25-20)27-24/h5-12,29H,13-14H2,1-4H3,(H,25,26,28)/q+1 |
| InChIKey | ULAFFZKZJQLGPC-UHFFFAOYSA-N |
| XLogP | 4.23 |
| TPSA | 148.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 500.56 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Azo_group', 'substructure': 'N/A'} |
|---|