C26H34N4O7S2 — CID 18184263
4-tert-butyl-N-[6-[2-(ethylsulfonylamino)ethoxy]-5-(2-methoxyphenoxy)-2-methylpyrimidin-4-yl]benzenesulfonamide (PubChem CID 18184263) has the molecular formula C26H34N4O7S2 and a molecular weight of 578.71 g/mol. Its IUPAC name is 4-tert-butyl-N-[6-[2-(ethylsulfonylamino)ethoxy]-5-(2-methoxyphenoxy)-2-methylpyrimidin-4-yl]benzenesulfonamide.
| Compound Name | 4-tert-butyl-N-[6-[2-(ethylsulfonylamino)ethoxy]-5-(2-methoxyphenoxy)-2-methylpyrimidin-4-yl]benzenesulfonamide |
|---|---|
| PubChem CID | 18184263 |
| Molecular Formula | C26H34N4O7S2 |
| Molecular Weight | 578.71 g/mol |
| Exact Mass | 578.19 |
| IUPAC Name | 4-tert-butyl-N-[6-[2-(ethylsulfonylamino)ethoxy]-5-(2-methoxyphenoxy)-2-methylpyrimidin-4-yl]benzenesulfonamide |
| SMILES | CCS(=O)(=O)NCCOc1nc(C)nc(NS(=O)(=O)c2ccc(C(C)(C)C)cc2)c1Oc1ccccc1OC |
| InChI | InChI=1S/C26H34N4O7S2/c1-7-38(31,32)27-16-17-36-25-23(37-22-11-9-8-10-21(22)35-6)24(28-18(2)29-25)30-39(33,34)20-14-12-19(13-15-20)26(3,4)5/h8-15,27H,7,16-17H2,1-6H3,(H,28,29,30) |
| InChIKey | INXHXQCGJCIVRM-UHFFFAOYSA-N |
| XLogP | 4.00 |
| TPSA | 145.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 578.71 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|