C25H32N4O7S2 — CID 154156089
2-butyl-N-[6-[2-(methanesulfonamido)ethoxy]-5-(2-methoxyphenoxy)-2-methylpyrimidin-4-yl]benzenesulfonamide (PubChem CID 154156089) has the molecular formula C25H32N4O7S2 and a molecular weight of 564.69 g/mol. Its IUPAC name is 2-butyl-N-[6-[2-(methanesulfonamido)ethoxy]-5-(2-methoxyphenoxy)-2-methylpyrimidin-4-yl]benzenesulfonamide.
| Compound Name | 2-butyl-N-[6-[2-(methanesulfonamido)ethoxy]-5-(2-methoxyphenoxy)-2-methylpyrimidin-4-yl]benzenesulfonamide |
|---|---|
| PubChem CID | 154156089 |
| Molecular Formula | C25H32N4O7S2 |
| Molecular Weight | 564.69 g/mol |
| Exact Mass | 564.17 |
| IUPAC Name | 2-butyl-N-[6-[2-(methanesulfonamido)ethoxy]-5-(2-methoxyphenoxy)-2-methylpyrimidin-4-yl]benzenesulfonamide |
| SMILES | CCCCc1ccccc1S(=O)(=O)Nc1nc(C)nc(OCCNS(C)(=O)=O)c1Oc1ccccc1OC |
| InChI | InChI=1S/C25H32N4O7S2/c1-5-6-11-19-12-7-10-15-22(19)38(32,33)29-24-23(36-21-14-9-8-13-20(21)34-3)25(28-18(2)27-24)35-17-16-26-37(4,30)31/h7-10,12-15,26H,5-6,11,16-17H2,1-4H3,(H,27,28,29) |
| InChIKey | NPAOMYMHPXKPFG-UHFFFAOYSA-N |
| XLogP | 3.66 |
| TPSA | 145.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 564.69 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|