About ethyl 2-(1H-imidazol-2-yl)ethanimidate;dihydrochloride
ethyl 2-(1H-imidazol-2-yl)ethanimidate;dihydrochloride (PubChem CID 19099228) has the molecular formula C7H13Cl2N3O
and a molecular weight of 226.11 g/mol. Its IUPAC name is ethyl 2-(1H-imidazol-2-yl)ethanimidate;dihydrochloride.
Molecular Properties
| Compound Name | ethyl 2-(1H-imidazol-2-yl)ethanimidate;dihydrochloride |
| PubChem CID | 19099228 |
| Molecular Formula | C7H13Cl2N3O |
| Molecular Weight | 226.11 g/mol |
| Exact Mass | 225.04 |
| IUPAC Name | ethyl 2-(1H-imidazol-2-yl)ethanimidate;dihydrochloride |
| SMILES | Cl.Cl.[H]/N=C(/Cc1ncc[nH]1)OCC |
| InChI | InChI=1S/C7H11N3O.2ClH/c1-2-11-6(8)5-7-9-3-4-10-7;;/h3-4,8H,2,5H2,1H3,(H,9,10);2*1H/b8-6-;; |
| InChIKey | IJQPRTJHRYXRMF-OTDBEEGXSA-N |
| XLogP | 1.81 |
| TPSA | 61.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 226.11 |
| LogP ≤ 5 | 1.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|
Analyze ethyl 2-(1H-imidazol-2-yl)ethanimidate;dihydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl 2-(1H-imidazol-2-yl)ethanimidate;dihydrochloride?
The IUPAC name of ethyl 2-(1H-imidazol-2-yl)ethanimidate;dihydrochloride (CID 19099228) is ethyl 2-(1H-imidazol-2-yl)ethanimidate;dihydrochloride.
What is the SMILES notation for ethyl 2-(1H-imidazol-2-yl)ethanimidate;dihydrochloride?
The canonical SMILES for ethyl 2-(1H-imidazol-2-yl)ethanimidate;dihydrochloride is Cl.Cl.[H]/N=C(/Cc1ncc[nH]1)OCC.
What is the InChIKey of ethyl 2-(1H-imidazol-2-yl)ethanimidate;dihydrochloride?
The InChIKey is IJQPRTJHRYXRMF-OTDBEEGXSA-N. The full InChI is InChI=1S/C7H11N3O.2ClH/c1-2-11-6(8)5-7-9-3-4-10-7;;/h3-4,8H,2,5H2,1H3,(H,9,10);2*1H/b8-6-;;.
What are the key properties of ethyl 2-(1H-imidazol-2-yl)ethanimidate;dihydrochloride?
ethyl 2-(1H-imidazol-2-yl)ethanimidate;dihydrochloride has a molecular weight of 226.11 g/mol, XLogP of 1.81, 3 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 2-(1H-imidazol-2-yl)ethanimidate;dihydrochloride is sourced from PubChem (CID 19099228), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).