C20H29NO6S — CID 19100735
ethyl 2-[bis[(2-methylpropan-2-yl)oxycarbonyl]amino]-4-cyclopropylthiophene-3-carboxylate (PubChem CID 19100735) has the molecular formula C20H29NO6S and a molecular weight of 411.52 g/mol. Its IUPAC name is ethyl 2-[bis[(2-methylpropan-2-yl)oxycarbonyl]amino]-4-cyclopropylthiophene-3-carboxylate.
| Compound Name | ethyl 2-[bis[(2-methylpropan-2-yl)oxycarbonyl]amino]-4-cyclopropylthiophene-3-carboxylate |
|---|---|
| PubChem CID | 19100735 |
| Molecular Formula | C20H29NO6S |
| Molecular Weight | 411.52 g/mol |
| Exact Mass | 411.17 |
| IUPAC Name | ethyl 2-[bis[(2-methylpropan-2-yl)oxycarbonyl]amino]-4-cyclopropylthiophene-3-carboxylate |
| SMILES | CCOC(=O)c1c(C2CC2)csc1N(C(=O)OC(C)(C)C)C(=O)OC(C)(C)C |
| InChI | InChI=1S/C20H29NO6S/c1-8-25-16(22)14-13(12-9-10-12)11-28-15(14)21(17(23)26-19(2,3)4)18(24)27-20(5,6)7/h11-12H,8-10H2,1-7H3 |
| InChIKey | FCIJAVNLDDQFNJ-UHFFFAOYSA-N |
| XLogP | 5.48 |
| TPSA | 82.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.52 |
| LogP ≤ 5 | 5.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|