C16H9F5N2O4 — CID 19115028
6-hydroxy-1,4-dimethyl-2-oxo-5-[2-(2,3,4,5,6-pentafluorophenoxy)acetyl]pyridine-3-carbonitrile (PubChem CID 19115028) has the molecular formula C16H9F5N2O4 and a molecular weight of 388.25 g/mol. Its IUPAC name is 6-hydroxy-1,4-dimethyl-2-oxo-5-[2-(2,3,4,5,6-pentafluorophenoxy)acetyl]pyridine-3-carbonitrile.
| Compound Name | 6-hydroxy-1,4-dimethyl-2-oxo-5-[2-(2,3,4,5,6-pentafluorophenoxy)acetyl]pyridine-3-carbonitrile |
|---|---|
| PubChem CID | 19115028 |
| Molecular Formula | C16H9F5N2O4 |
| Molecular Weight | 388.25 g/mol |
| Exact Mass | 388.05 |
| IUPAC Name | 6-hydroxy-1,4-dimethyl-2-oxo-5-[2-(2,3,4,5,6-pentafluorophenoxy)acetyl]pyridine-3-carbonitrile |
| SMILES | Cc1c(C(=O)COc2c(F)c(F)c(F)c(F)c2F)c(O)n(C)c(=O)c1C#N |
| InChI | InChI=1S/C16H9F5N2O4/c1-5-6(3-22)15(25)23(2)16(26)8(5)7(24)4-27-14-12(20)10(18)9(17)11(19)13(14)21/h26H,4H2,1-2H3 |
| InChIKey | PWVXOZRLPMHPKX-UHFFFAOYSA-N |
| XLogP | 2.23 |
| TPSA | 92.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.25 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|