C19H19FN2O3 — CID 19115544
5-(2-fluorobenzoyl)-6-hydroxy-4-methyl-2-oxo-1-pentylpyridine-3-carbonitrile (PubChem CID 19115544) has the molecular formula C19H19FN2O3 and a molecular weight of 342.37 g/mol. Its IUPAC name is 5-(2-fluorobenzoyl)-6-hydroxy-4-methyl-2-oxo-1-pentylpyridine-3-carbonitrile.
| Compound Name | 5-(2-fluorobenzoyl)-6-hydroxy-4-methyl-2-oxo-1-pentylpyridine-3-carbonitrile |
|---|---|
| PubChem CID | 19115544 |
| Molecular Formula | C19H19FN2O3 |
| Molecular Weight | 342.37 g/mol |
| Exact Mass | 342.14 |
| IUPAC Name | 5-(2-fluorobenzoyl)-6-hydroxy-4-methyl-2-oxo-1-pentylpyridine-3-carbonitrile |
| SMILES | CCCCCn1c(O)c(C(=O)c2ccccc2F)c(C)c(C#N)c1=O |
| InChI | InChI=1S/C19H19FN2O3/c1-3-4-7-10-22-18(24)14(11-21)12(2)16(19(22)25)17(23)13-8-5-6-9-15(13)20/h5-6,8-9,25H,3-4,7,10H2,1-2H3 |
| InChIKey | DXEXNKAHRLIPEI-UHFFFAOYSA-N |
| XLogP | 3.29 |
| TPSA | 83.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.37 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|