C18H18N2O5 — CID 19116944
6-hydroxy-5-(3-methoxybenzoyl)-1-(2-methoxyethyl)-4-methyl-2-oxopyridine-3-carbonitrile (PubChem CID 19116944) has the molecular formula C18H18N2O5 and a molecular weight of 342.35 g/mol. Its IUPAC name is 6-hydroxy-5-(3-methoxybenzoyl)-1-(2-methoxyethyl)-4-methyl-2-oxopyridine-3-carbonitrile.
| Compound Name | 6-hydroxy-5-(3-methoxybenzoyl)-1-(2-methoxyethyl)-4-methyl-2-oxopyridine-3-carbonitrile |
|---|---|
| PubChem CID | 19116944 |
| Molecular Formula | C18H18N2O5 |
| Molecular Weight | 342.35 g/mol |
| Exact Mass | 342.12 |
| IUPAC Name | 6-hydroxy-5-(3-methoxybenzoyl)-1-(2-methoxyethyl)-4-methyl-2-oxopyridine-3-carbonitrile |
| SMILES | COCCn1c(O)c(C(=O)c2cccc(OC)c2)c(C)c(C#N)c1=O |
| InChI | InChI=1S/C18H18N2O5/c1-11-14(10-19)17(22)20(7-8-24-2)18(23)15(11)16(21)12-5-4-6-13(9-12)25-3/h4-6,9,23H,7-8H2,1-3H3 |
| InChIKey | ZDKRTYDUJRFJJD-UHFFFAOYSA-N |
| XLogP | 1.62 |
| TPSA | 101.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.35 |
| LogP ≤ 5 | 1.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |