C28H30N2O6 — CID 19118218
5-(3-butoxybenzoyl)-1-[2-(3,4-dimethoxyphenyl)ethyl]-6-hydroxy-4-methyl-2-oxopyridine-3-carbonitrile (PubChem CID 19118218) has the molecular formula C28H30N2O6 and a molecular weight of 490.56 g/mol. Its IUPAC name is 5-(3-butoxybenzoyl)-1-[2-(3,4-dimethoxyphenyl)ethyl]-6-hydroxy-4-methyl-2-oxopyridine-3-carbonitrile.
| Compound Name | 5-(3-butoxybenzoyl)-1-[2-(3,4-dimethoxyphenyl)ethyl]-6-hydroxy-4-methyl-2-oxopyridine-3-carbonitrile |
|---|---|
| PubChem CID | 19118218 |
| Molecular Formula | C28H30N2O6 |
| Molecular Weight | 490.56 g/mol |
| Exact Mass | 490.21 |
| IUPAC Name | 5-(3-butoxybenzoyl)-1-[2-(3,4-dimethoxyphenyl)ethyl]-6-hydroxy-4-methyl-2-oxopyridine-3-carbonitrile |
| SMILES | CCCCOc1cccc(C(=O)c2c(C)c(C#N)c(=O)n(CCc3ccc(OC)c(OC)c3)c2O)c1 |
| InChI | InChI=1S/C28H30N2O6/c1-5-6-14-36-21-9-7-8-20(16-21)26(31)25-18(2)22(17-29)27(32)30(28(25)33)13-12-19-10-11-23(34-3)24(15-19)35-4/h7-11,15-16,33H,5-6,12-14H2,1-4H3 |
| InChIKey | AIEZBJSMVYSJHN-UHFFFAOYSA-N |
| XLogP | 4.40 |
| TPSA | 110.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.56 |
| LogP ≤ 5 | 4.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|