C27H26Cl2N2O5 — CID 19118111
5-(4-butoxy-3,5-dichlorobenzoyl)-6-hydroxy-1-[2-(4-methoxyphenyl)ethyl]-4-methyl-2-oxopyridine-3-carbonitrile (PubChem CID 19118111) has the molecular formula C27H26Cl2N2O5 and a molecular weight of 529.42 g/mol. Its IUPAC name is 5-(4-butoxy-3,5-dichlorobenzoyl)-6-hydroxy-1-[2-(4-methoxyphenyl)ethyl]-4-methyl-2-oxopyridine-3-carbonitrile.
| Compound Name | 5-(4-butoxy-3,5-dichlorobenzoyl)-6-hydroxy-1-[2-(4-methoxyphenyl)ethyl]-4-methyl-2-oxopyridine-3-carbonitrile |
|---|---|
| PubChem CID | 19118111 |
| Molecular Formula | C27H26Cl2N2O5 |
| Molecular Weight | 529.42 g/mol |
| Exact Mass | 528.12 |
| IUPAC Name | 5-(4-butoxy-3,5-dichlorobenzoyl)-6-hydroxy-1-[2-(4-methoxyphenyl)ethyl]-4-methyl-2-oxopyridine-3-carbonitrile |
| SMILES | CCCCOc1c(Cl)cc(C(=O)c2c(C)c(C#N)c(=O)n(CCc3ccc(OC)cc3)c2O)cc1Cl |
| InChI | InChI=1S/C27H26Cl2N2O5/c1-4-5-12-36-25-21(28)13-18(14-22(25)29)24(32)23-16(2)20(15-30)26(33)31(27(23)34)11-10-17-6-8-19(35-3)9-7-17/h6-9,13-14,34H,4-5,10-12H2,1-3H3 |
| InChIKey | IERXXYWTPMNUHL-UHFFFAOYSA-N |
| XLogP | 5.70 |
| TPSA | 101.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 529.42 |
| LogP ≤ 5 | 5.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|