C27H26Cl2N2O4 — CID 19117710
5-(3,5-dichloro-4-pentoxybenzoyl)-6-hydroxy-4-methyl-2-oxo-1-(1-phenylethyl)pyridine-3-carbonitrile (PubChem CID 19117710) has the molecular formula C27H26Cl2N2O4 and a molecular weight of 513.42 g/mol. Its IUPAC name is 5-(3,5-dichloro-4-pentoxybenzoyl)-6-hydroxy-4-methyl-2-oxo-1-(1-phenylethyl)pyridine-3-carbonitrile.
| Compound Name | 5-(3,5-dichloro-4-pentoxybenzoyl)-6-hydroxy-4-methyl-2-oxo-1-(1-phenylethyl)pyridine-3-carbonitrile |
|---|---|
| PubChem CID | 19117710 |
| Molecular Formula | C27H26Cl2N2O4 |
| Molecular Weight | 513.42 g/mol |
| Exact Mass | 512.13 |
| IUPAC Name | 5-(3,5-dichloro-4-pentoxybenzoyl)-6-hydroxy-4-methyl-2-oxo-1-(1-phenylethyl)pyridine-3-carbonitrile |
| SMILES | CCCCCOc1c(Cl)cc(C(=O)c2c(C)c(C#N)c(=O)n(C(C)c3ccccc3)c2O)cc1Cl |
| InChI | InChI=1S/C27H26Cl2N2O4/c1-4-5-9-12-35-25-21(28)13-19(14-22(25)29)24(32)23-16(2)20(15-30)26(33)31(27(23)34)17(3)18-10-7-6-8-11-18/h6-8,10-11,13-14,17,34H,4-5,9,12H2,1-3H3 |
| InChIKey | ADCXOLFXCJPXSH-UHFFFAOYSA-N |
| XLogP | 6.45 |
| TPSA | 92.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 513.42 |
| LogP ≤ 5 | 6.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|