C24H26Cl2N2O4 — CID 19116238
1-cyclopentyl-5-(3,5-dichloro-4-pentoxybenzoyl)-6-hydroxy-4-methyl-2-oxopyridine-3-carbonitrile (PubChem CID 19116238) has the molecular formula C24H26Cl2N2O4 and a molecular weight of 477.39 g/mol. Its IUPAC name is 1-cyclopentyl-5-(3,5-dichloro-4-pentoxybenzoyl)-6-hydroxy-4-methyl-2-oxopyridine-3-carbonitrile.
| Compound Name | 1-cyclopentyl-5-(3,5-dichloro-4-pentoxybenzoyl)-6-hydroxy-4-methyl-2-oxopyridine-3-carbonitrile |
|---|---|
| PubChem CID | 19116238 |
| Molecular Formula | C24H26Cl2N2O4 |
| Molecular Weight | 477.39 g/mol |
| Exact Mass | 476.13 |
| IUPAC Name | 1-cyclopentyl-5-(3,5-dichloro-4-pentoxybenzoyl)-6-hydroxy-4-methyl-2-oxopyridine-3-carbonitrile |
| SMILES | CCCCCOc1c(Cl)cc(C(=O)c2c(C)c(C#N)c(=O)n(C3CCCC3)c2O)cc1Cl |
| InChI | InChI=1S/C24H26Cl2N2O4/c1-3-4-7-10-32-22-18(25)11-15(12-19(22)26)21(29)20-14(2)17(13-27)23(30)28(24(20)31)16-8-5-6-9-16/h11-12,16,31H,3-10H2,1-2H3 |
| InChIKey | JOTNOLFKYDREBJ-UHFFFAOYSA-N |
| XLogP | 5.96 |
| TPSA | 92.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.39 |
| LogP ≤ 5 | 5.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|