C27H34Cl2N2O4 — CID 19118782
5-(3,5-dichloro-4-heptoxybenzoyl)-1-hexyl-6-hydroxy-4-methyl-2-oxopyridine-3-carbonitrile (PubChem CID 19118782) has the molecular formula C27H34Cl2N2O4 and a molecular weight of 521.49 g/mol. Its IUPAC name is 5-(3,5-dichloro-4-heptoxybenzoyl)-1-hexyl-6-hydroxy-4-methyl-2-oxopyridine-3-carbonitrile.
| Compound Name | 5-(3,5-dichloro-4-heptoxybenzoyl)-1-hexyl-6-hydroxy-4-methyl-2-oxopyridine-3-carbonitrile |
|---|---|
| PubChem CID | 19118782 |
| Molecular Formula | C27H34Cl2N2O4 |
| Molecular Weight | 521.49 g/mol |
| Exact Mass | 520.19 |
| IUPAC Name | 5-(3,5-dichloro-4-heptoxybenzoyl)-1-hexyl-6-hydroxy-4-methyl-2-oxopyridine-3-carbonitrile |
| SMILES | CCCCCCCOc1c(Cl)cc(C(=O)c2c(C)c(C#N)c(=O)n(CCCCCC)c2O)cc1Cl |
| InChI | InChI=1S/C27H34Cl2N2O4/c1-4-6-8-10-12-14-35-25-21(28)15-19(16-22(25)29)24(32)23-18(3)20(17-30)26(33)31(27(23)34)13-11-9-7-5-2/h15-16,34H,4-14H2,1-3H3 |
| InChIKey | XPNBWDGYLKYWML-UHFFFAOYSA-N |
| XLogP | 7.20 |
| TPSA | 92.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 521.49 |
| LogP ≤ 5 | 7.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|