C26H24Cl2N2O4 — CID 19117977
5-(4-butoxy-3,5-dichlorobenzoyl)-6-hydroxy-4-methyl-1-[(4-methylphenyl)methyl]-2-oxopyridine-3-carbonitrile (PubChem CID 19117977) has the molecular formula C26H24Cl2N2O4 and a molecular weight of 499.39 g/mol. Its IUPAC name is 5-(4-butoxy-3,5-dichlorobenzoyl)-6-hydroxy-4-methyl-1-[(4-methylphenyl)methyl]-2-oxopyridine-3-carbonitrile.
| Compound Name | 5-(4-butoxy-3,5-dichlorobenzoyl)-6-hydroxy-4-methyl-1-[(4-methylphenyl)methyl]-2-oxopyridine-3-carbonitrile |
|---|---|
| PubChem CID | 19117977 |
| Molecular Formula | C26H24Cl2N2O4 |
| Molecular Weight | 499.39 g/mol |
| Exact Mass | 498.11 |
| IUPAC Name | 5-(4-butoxy-3,5-dichlorobenzoyl)-6-hydroxy-4-methyl-1-[(4-methylphenyl)methyl]-2-oxopyridine-3-carbonitrile |
| SMILES | CCCCOc1c(Cl)cc(C(=O)c2c(C)c(C#N)c(=O)n(Cc3ccc(C)cc3)c2O)cc1Cl |
| InChI | InChI=1S/C26H24Cl2N2O4/c1-4-5-10-34-24-20(27)11-18(12-21(24)28)23(31)22-16(3)19(13-29)25(32)30(26(22)33)14-17-8-6-15(2)7-9-17/h6-9,11-12,33H,4-5,10,14H2,1-3H3 |
| InChIKey | NYSKCXXEXPXVSI-UHFFFAOYSA-N |
| XLogP | 5.81 |
| TPSA | 92.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 499.39 |
| LogP ≤ 5 | 5.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|