C21H23N3O7 — CID 19117357
6-hydroxy-4-methyl-5-[2-(2-nitrophenoxy)acetyl]-2-oxo-1-(3-propan-2-yloxypropyl)pyridine-3-carbonitrile (PubChem CID 19117357) has the molecular formula C21H23N3O7 and a molecular weight of 429.43 g/mol. Its IUPAC name is 6-hydroxy-4-methyl-5-[2-(2-nitrophenoxy)acetyl]-2-oxo-1-(3-propan-2-yloxypropyl)pyridine-3-carbonitrile.
| Compound Name | 6-hydroxy-4-methyl-5-[2-(2-nitrophenoxy)acetyl]-2-oxo-1-(3-propan-2-yloxypropyl)pyridine-3-carbonitrile |
|---|---|
| PubChem CID | 19117357 |
| Molecular Formula | C21H23N3O7 |
| Molecular Weight | 429.43 g/mol |
| Exact Mass | 429.15 |
| IUPAC Name | 6-hydroxy-4-methyl-5-[2-(2-nitrophenoxy)acetyl]-2-oxo-1-(3-propan-2-yloxypropyl)pyridine-3-carbonitrile |
| SMILES | Cc1c(C(=O)COc2ccccc2[N+](=O)[O-])c(O)n(CCCOC(C)C)c(=O)c1C#N |
| InChI | InChI=1S/C21H23N3O7/c1-13(2)30-10-6-9-23-20(26)15(11-22)14(3)19(21(23)27)17(25)12-31-18-8-5-4-7-16(18)24(28)29/h4-5,7-8,13,27H,6,9-10,12H2,1-3H3 |
| InChIKey | IAXSZSOTMKAJSP-UHFFFAOYSA-N |
| XLogP | 2.72 |
| TPSA | 144.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.43 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|