C21H19F5N2O4 — CID 19118772
1-hexyl-6-hydroxy-4-methyl-2-oxo-5-[2-(2,3,4,5,6-pentafluorophenoxy)acetyl]pyridine-3-carbonitrile (PubChem CID 19118772) has the molecular formula C21H19F5N2O4 and a molecular weight of 458.38 g/mol. Its IUPAC name is 1-hexyl-6-hydroxy-4-methyl-2-oxo-5-[2-(2,3,4,5,6-pentafluorophenoxy)acetyl]pyridine-3-carbonitrile.
| Compound Name | 1-hexyl-6-hydroxy-4-methyl-2-oxo-5-[2-(2,3,4,5,6-pentafluorophenoxy)acetyl]pyridine-3-carbonitrile |
|---|---|
| PubChem CID | 19118772 |
| Molecular Formula | C21H19F5N2O4 |
| Molecular Weight | 458.38 g/mol |
| Exact Mass | 458.13 |
| IUPAC Name | 1-hexyl-6-hydroxy-4-methyl-2-oxo-5-[2-(2,3,4,5,6-pentafluorophenoxy)acetyl]pyridine-3-carbonitrile |
| SMILES | CCCCCCn1c(O)c(C(=O)COc2c(F)c(F)c(F)c(F)c2F)c(C)c(C#N)c1=O |
| InChI | InChI=1S/C21H19F5N2O4/c1-3-4-5-6-7-28-20(30)11(8-27)10(2)13(21(28)31)12(29)9-32-19-17(25)15(23)14(22)16(24)18(19)26/h31H,3-7,9H2,1-2H3 |
| InChIKey | XVIMXOARNSBXSV-UHFFFAOYSA-N |
| XLogP | 4.27 |
| TPSA | 92.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.38 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|