C25H28N2O4 — CID 19118788
1-hexyl-6-hydroxy-4-methyl-2-oxo-5-(3,4,6-trimethyl-1-benzofuran-2-carbonyl)pyridine-3-carbonitrile (PubChem CID 19118788) has the molecular formula C25H28N2O4 and a molecular weight of 420.51 g/mol. Its IUPAC name is 1-hexyl-6-hydroxy-4-methyl-2-oxo-5-(3,4,6-trimethyl-1-benzofuran-2-carbonyl)pyridine-3-carbonitrile.
| Compound Name | 1-hexyl-6-hydroxy-4-methyl-2-oxo-5-(3,4,6-trimethyl-1-benzofuran-2-carbonyl)pyridine-3-carbonitrile |
|---|---|
| PubChem CID | 19118788 |
| Molecular Formula | C25H28N2O4 |
| Molecular Weight | 420.51 g/mol |
| Exact Mass | 420.20 |
| IUPAC Name | 1-hexyl-6-hydroxy-4-methyl-2-oxo-5-(3,4,6-trimethyl-1-benzofuran-2-carbonyl)pyridine-3-carbonitrile |
| SMILES | CCCCCCn1c(O)c(C(=O)c2oc3cc(C)cc(C)c3c2C)c(C)c(C#N)c1=O |
| InChI | InChI=1S/C25H28N2O4/c1-6-7-8-9-10-27-24(29)18(13-26)16(4)21(25(27)30)22(28)23-17(5)20-15(3)11-14(2)12-19(20)31-23/h11-12,30H,6-10H2,1-5H3 |
| InChIKey | KVMWHCMLGLELTQ-UHFFFAOYSA-N |
| XLogP | 5.22 |
| TPSA | 96.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.51 |
| LogP ≤ 5 | 5.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|