C23H29NO4S — CID 19120371
2-butoxy-N-(1,1-dioxothiolan-3-yl)-N-[(4-methylphenyl)methyl]benzamide (PubChem CID 19120371) has the molecular formula C23H29NO4S and a molecular weight of 415.56 g/mol. Its IUPAC name is 2-butoxy-N-(1,1-dioxothiolan-3-yl)-N-[(4-methylphenyl)methyl]benzamide.
| Compound Name | 2-butoxy-N-(1,1-dioxothiolan-3-yl)-N-[(4-methylphenyl)methyl]benzamide |
|---|---|
| PubChem CID | 19120371 |
| Molecular Formula | C23H29NO4S |
| Molecular Weight | 415.56 g/mol |
| Exact Mass | 415.18 |
| IUPAC Name | 2-butoxy-N-(1,1-dioxothiolan-3-yl)-N-[(4-methylphenyl)methyl]benzamide |
| SMILES | CCCCOc1ccccc1C(=O)N(Cc1ccc(C)cc1)C1CCS(=O)(=O)C1 |
| InChI | InChI=1S/C23H29NO4S/c1-3-4-14-28-22-8-6-5-7-21(22)23(25)24(20-13-15-29(26,27)17-20)16-19-11-9-18(2)10-12-19/h5-12,20H,3-4,13-17H2,1-2H3 |
| InChIKey | QAYDLTIBCPMXIX-UHFFFAOYSA-N |
| XLogP | 4.00 |
| TPSA | 63.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.56 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|