C20H24BrNO5S — CID 42278531
N-[(5-bromofuran-2-yl)methyl]-2-butoxy-N-[(3R)-1,1-dioxothiolan-3-yl]benzamide (PubChem CID 42278531) has the molecular formula C20H24BrNO5S and a molecular weight of 470.39 g/mol. Its IUPAC name is N-[(5-bromofuran-2-yl)methyl]-2-butoxy-N-[(3R)-1,1-dioxothiolan-3-yl]benzamide.
| Compound Name | N-[(5-bromofuran-2-yl)methyl]-2-butoxy-N-[(3R)-1,1-dioxothiolan-3-yl]benzamide |
|---|---|
| PubChem CID | 42278531 |
| Molecular Formula | C20H24BrNO5S |
| Molecular Weight | 470.39 g/mol |
| Exact Mass | 469.06 |
| IUPAC Name | N-[(5-bromofuran-2-yl)methyl]-2-butoxy-N-[(3R)-1,1-dioxothiolan-3-yl]benzamide |
| SMILES | CCCCOc1ccccc1C(=O)N(Cc1ccc(Br)o1)[C@@H]1CCS(=O)(=O)C1 |
| InChI | InChI=1S/C20H24BrNO5S/c1-2-3-11-26-18-7-5-4-6-17(18)20(23)22(13-16-8-9-19(21)27-16)15-10-12-28(24,25)14-15/h4-9,15H,2-3,10-14H2,1H3/t15-/m1/s1 |
| InChIKey | GLZFDWMKIMYONH-OAHLLOKOSA-N |
| XLogP | 4.05 |
| TPSA | 76.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.39 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|