C31H23N3O6 — CID 19126534
[2-amino-3-cyano-4-[3-[(4-methylphenyl)methoxy]phenyl]-4H-chromen-7-yl] 3-nitrobenzoate (PubChem CID 19126534) has the molecular formula C31H23N3O6 and a molecular weight of 533.54 g/mol. Its IUPAC name is [2-amino-3-cyano-4-[3-[(4-methylphenyl)methoxy]phenyl]-4H-chromen-7-yl] 3-nitrobenzoate.
| Compound Name | [2-amino-3-cyano-4-[3-[(4-methylphenyl)methoxy]phenyl]-4H-chromen-7-yl] 3-nitrobenzoate |
|---|---|
| PubChem CID | 19126534 |
| Molecular Formula | C31H23N3O6 |
| Molecular Weight | 533.54 g/mol |
| Exact Mass | 533.16 |
| IUPAC Name | [2-amino-3-cyano-4-[3-[(4-methylphenyl)methoxy]phenyl]-4H-chromen-7-yl] 3-nitrobenzoate |
| SMILES | Cc1ccc(COc2cccc(C3C(C#N)=C(N)Oc4cc(OC(=O)c5cccc([N+](=O)[O-])c5)ccc43)c2)cc1 |
| InChI | InChI=1S/C31H23N3O6/c1-19-8-10-20(11-9-19)18-38-24-7-3-4-21(15-24)29-26-13-12-25(16-28(26)40-30(33)27(29)17-32)39-31(35)22-5-2-6-23(14-22)34(36)37/h2-16,29H,18,33H2,1H3 |
| InChIKey | KVSDSKGBFWCHDJ-UHFFFAOYSA-N |
| XLogP | 5.92 |
| TPSA | 137.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 533.54 |
| LogP ≤ 5 | 5.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|