C21H19NO4 — CID 19130385
1-(4-butoxyphenyl)-1,2-dihydrochromeno[2,3-c]pyrrole-3,9-dione (PubChem CID 19130385) has the molecular formula C21H19NO4 and a molecular weight of 349.39 g/mol. Its IUPAC name is 1-(4-butoxyphenyl)-1,2-dihydrochromeno[2,3-c]pyrrole-3,9-dione.
| Compound Name | 1-(4-butoxyphenyl)-1,2-dihydrochromeno[2,3-c]pyrrole-3,9-dione |
|---|---|
| PubChem CID | 19130385 |
| Molecular Formula | C21H19NO4 |
| Molecular Weight | 349.39 g/mol |
| Exact Mass | 349.13 |
| IUPAC Name | 1-(4-butoxyphenyl)-1,2-dihydrochromeno[2,3-c]pyrrole-3,9-dione |
| SMILES | CCCCOc1ccc(C2NC(=O)c3oc4ccccc4c(=O)c32)cc1 |
| InChI | InChI=1S/C21H19NO4/c1-2-3-12-25-14-10-8-13(9-11-14)18-17-19(23)15-6-4-5-7-16(15)26-20(17)21(24)22-18/h4-11,18H,2-3,12H2,1H3,(H,22,24) |
| InChIKey | LSWBSAZYKRMUNP-UHFFFAOYSA-N |
| XLogP | 3.80 |
| TPSA | 68.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.39 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|