C22H20ClNO4 — CID 19130688
1-(4-butoxyphenyl)-7-chloro-6-methyl-1,2-dihydrochromeno[2,3-c]pyrrole-3,9-dione (PubChem CID 19130688) has the molecular formula C22H20ClNO4 and a molecular weight of 397.86 g/mol. Its IUPAC name is 1-(4-butoxyphenyl)-7-chloro-6-methyl-1,2-dihydrochromeno[2,3-c]pyrrole-3,9-dione.
| Compound Name | 1-(4-butoxyphenyl)-7-chloro-6-methyl-1,2-dihydrochromeno[2,3-c]pyrrole-3,9-dione |
|---|---|
| PubChem CID | 19130688 |
| Molecular Formula | C22H20ClNO4 |
| Molecular Weight | 397.86 g/mol |
| Exact Mass | 397.11 |
| IUPAC Name | 1-(4-butoxyphenyl)-7-chloro-6-methyl-1,2-dihydrochromeno[2,3-c]pyrrole-3,9-dione |
| SMILES | CCCCOc1ccc(C2NC(=O)c3oc4cc(C)c(Cl)cc4c(=O)c32)cc1 |
| InChI | InChI=1S/C22H20ClNO4/c1-3-4-9-27-14-7-5-13(6-8-14)19-18-20(25)15-11-16(23)12(2)10-17(15)28-21(18)22(26)24-19/h5-8,10-11,19H,3-4,9H2,1-2H3,(H,24,26) |
| InChIKey | KNOFKLVRHYYSGA-UHFFFAOYSA-N |
| XLogP | 4.77 |
| TPSA | 68.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.86 |
| LogP ≤ 5 | 4.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|