C16H7BrCl2O4 — CID 19132910
(2,5-dichlorophenyl) 6-bromo-2-oxochromene-3-carboxylate (PubChem CID 19132910) has the molecular formula C16H7BrCl2O4 and a molecular weight of 414.04 g/mol. Its IUPAC name is (2,5-dichlorophenyl) 6-bromo-2-oxochromene-3-carboxylate.
| Compound Name | (2,5-dichlorophenyl) 6-bromo-2-oxochromene-3-carboxylate |
|---|---|
| PubChem CID | 19132910 |
| Molecular Formula | C16H7BrCl2O4 |
| Molecular Weight | 414.04 g/mol |
| Exact Mass | 411.89 |
| IUPAC Name | (2,5-dichlorophenyl) 6-bromo-2-oxochromene-3-carboxylate |
| SMILES | O=C(Oc1cc(Cl)ccc1Cl)c1cc2cc(Br)ccc2oc1=O |
| InChI | InChI=1S/C16H7BrCl2O4/c17-9-1-4-13-8(5-9)6-11(15(20)22-13)16(21)23-14-7-10(18)2-3-12(14)19/h1-7H |
| InChIKey | WWKFZKKUZCNMNM-UHFFFAOYSA-N |
| XLogP | 5.08 |
| TPSA | 56.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.04 |
| LogP ≤ 5 | 5.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|